C30H52O4Si — CID 59732534
(2,5-dimethylcyclohepta-2,5-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate (PubChem CID 59732534) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is (2,5-dimethylcyclohepta-2,5-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate.
| Compound Name | (2,5-dimethylcyclohepta-2,5-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 59732534 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | (2,5-dimethylcyclohepta-2,5-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(=O)OC1CC=C(C)CC=C1C |
| InChI | InChI=1S/C30H52O4Si/c1-14-21(3)27(34-35(12,13)29(7,8)9)24(6)28(32)30(10,11)23(5)19-26(31)33-25-18-16-20(2)15-17-22(25)4/h14,16-17,21,23-25,27H,1,15,18-19H2,2-13H3/t21-,23-,24+,25?,27-/m0/s1 |
| InChIKey | RROOPOUGWDKRNC-DOZXVJQGSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|