C29H47F3O5Si — CID 59732568
(4S,8S,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 59732568) has the molecular formula C29H47F3O5Si and a molecular weight of 560.77 g/mol. Its IUPAC name is (4S,8S,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,8S,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 59732568 |
| Molecular Formula | C29H47F3O5Si |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (4S,8S,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=O)[C@@H]1C/C=C(/C(F)(F)F)C/C=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C(=O)C(C)(C)[C@@H](C)CC(=O)O1 |
| InChI | InChI=1S/C29H47F3O5Si/c1-18-13-12-14-22(29(30,31)32)15-16-23(21(4)33)36-24(34)17-19(2)28(8,9)26(35)20(3)25(18)37-38(10,11)27(5,6)7/h12-13,15,18-20,23,25H,14,16-17H2,1-11H3/b13-12+,22-15+/t18-,19-,20?,23-,25-/m0/s1 |
| InChIKey | KYQGQZVLFJIWNL-PNWLPBJLSA-N |
| XLogP | 7.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|