C32H53F3O5Si — CID 59732598
[(5E)-3-methyl-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate (PubChem CID 59732598) has the molecular formula C32H53F3O5Si and a molecular weight of 602.85 g/mol. Its IUPAC name is [(5E)-3-methyl-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate.
| Compound Name | [(5E)-3-methyl-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
|---|---|
| PubChem CID | 59732598 |
| Molecular Formula | C32H53F3O5Si |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | [(5E)-3-methyl-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,8-pentamethyl-5-oxodec-9-enoate |
| SMILES | C=CC/C(=C\CC(C)(OC(=O)C[C@H](C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C=C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C32H53F3O5Si/c1-15-17-25(32(33,34)35)18-19-31(12,24(6)36)39-26(37)20-22(4)30(10,11)28(38)23(5)27(21(3)16-2)40-41(13,14)29(7,8)9/h15-16,18,21-23,27H,1-2,17,19-20H2,3-14H3/b25-18+/t21?,22-,23+,27-,31?/m0/s1 |
| InChIKey | UFCBLOOHGWZHRJ-FRIYDQOGSA-N |
| XLogP | 8.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|