C33H39N3O4 — CID 59733170
9H-fluoren-9-ylmethyl N-[2-[ethyl-[2-(4-methoxyanilino)ethyl]carbamoyl]cyclohexyl]carbamate (PubChem CID 59733170) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[ethyl-[2-(4-methoxyanilino)ethyl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[ethyl-[2-(4-methoxyanilino)ethyl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59733170 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[ethyl-[2-(4-methoxyanilino)ethyl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CCN(CCNc1ccc(OC)cc1)C(=O)C1CCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H39N3O4/c1-3-36(21-20-34-23-16-18-24(39-2)19-17-23)32(37)29-14-8-9-15-31(29)35-33(38)40-22-30-27-12-6-4-10-25(27)26-11-5-7-13-28(26)30/h4-7,10-13,16-19,29-31,34H,3,8-9,14-15,20-22H2,1-2H3,(H,35,38) |
| InChIKey | LEJNIEYXYLPBHX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|