C21H19ClF2N6O2 — CID 59733311
N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 59733311) has the molecular formula C21H19ClF2N6O2 and a molecular weight of 460.87 g/mol. Its IUPAC name is N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59733311 |
| Molecular Formula | C21H19ClF2N6O2 |
| Molecular Weight | 460.87 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[1-(6-chloro-2-pyridinyl)piperidin-4-yl]-4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCN(c2cccc(Cl)n2)CC1)c1[nH]ncc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C21H19ClF2N6O2/c22-16-5-2-6-17(28-16)30-9-7-12(8-10-30)26-21(32)19-15(11-25-29-19)27-20(31)18-13(23)3-1-4-14(18)24/h1-6,11-12H,7-10H2,(H,25,29)(H,26,32)(H,27,31) |
| InChIKey | ZUSYSJGZKXAGFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|