About methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate
methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate (PubChem CID 59733315) has the molecular formula C19H15F2N5O4
and a molecular weight of 415.36 g/mol. Its IUPAC name is methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate |
| PubChem CID | 59733315 |
| Molecular Formula | C19H15F2N5O4 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2[nH]ncc2NC(=O)c2c(F)cccc2F)c1N |
| InChI | InChI=1S/C19H15F2N5O4/c1-30-19(29)9-4-2-7-12(15(9)22)24-18(28)16-13(8-23-26-16)25-17(27)14-10(20)5-3-6-11(14)21/h2-8H,22H2,1H3,(H,23,26)(H,24,28)(H,25,27) |
| InChIKey | ITHZOMIBUXMIQC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate?
The IUPAC name of methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate (CID 59733315) is methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate.
What is the SMILES notation for methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate?
The canonical SMILES for methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate is COC(=O)c1cccc(NC(=O)c2[nH]ncc2NC(=O)c2c(F)cccc2F)c1N.
What is the InChIKey of methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate?
The InChIKey is ITHZOMIBUXMIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N5O4/c1-30-19(29)9-4-2-7-12(15(9)22)24-18(28)16-13(8-23-26-16)25-17(27)14-10(20)5-3-6-11(14)21/h2-8H,22H2,1H3,(H,23,26)(H,24,28)(H,25,27).
What are the key properties of methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate?
methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate has a molecular weight of 415.36 g/mol, XLogP of 2.56, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-[[4-[(2,6-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]amino]benzoate is sourced from PubChem (CID 59733315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).