C17H12FN5O4 — CID 59733390
N-(4-fluorophenyl)-4-[(3-nitrobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 59733390) has the molecular formula C17H12FN5O4 and a molecular weight of 369.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[(3-nitrobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-[(3-nitrobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59733390 |
| Molecular Formula | C17H12FN5O4 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-(4-fluorophenyl)-4-[(3-nitrobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1C(=O)Nc1ccc(F)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12FN5O4/c18-11-4-6-12(7-5-11)20-17(25)15-14(9-19-22-15)21-16(24)10-2-1-3-13(8-10)23(26)27/h1-9H,(H,19,22)(H,20,25)(H,21,24) |
| InChIKey | UTTQAFZVQSYIKR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|