C22H21Cl4NO2Rh2-2 — CID 59733579
2-[(1R)-1-(1-adamantyl)-2-methanidylpropyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) (PubChem CID 59733579) has the molecular formula C22H21Cl4NO2Rh2-2 and a molecular weight of 679.04 g/mol. Its IUPAC name is 2-[(1R)-1-(1-adamantyl)-2-methanidylpropyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium).
| Compound Name | 2-[(1R)-1-(1-adamantyl)-2-methanidylpropyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) |
|---|---|
| PubChem CID | 59733579 |
| Molecular Formula | C22H21Cl4NO2Rh2-2 |
| Molecular Weight | 679.04 g/mol |
| Exact Mass | 676.84 |
| IUPAC Name | 2-[(1R)-1-(1-adamantyl)-2-methanidylpropyl]-4,5,6,7-tetrachloroisoindole-1,3-dione;bis(rhodium) |
| SMILES | [CH2-]C([CH2-])[C@@H](N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)C12CC3CC(CC(C3)C1)C2.[Rh].[Rh] |
| InChI | InChI=1S/C22H21Cl4NO2.2Rh/c1-9(2)19(22-6-10-3-11(7-22)5-12(4-10)8-22)27-20(28)13-14(21(27)29)16(24)18(26)17(25)15(13)23;;/h9-12,19H,1-8H2;;/q-2;;/t10?,11?,12?,19-,22?;;/m1../s1 |
| InChIKey | WQYJOUWHXMZPQY-LRHYIVTBSA-N |
| XLogP | 6.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.04 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|