C24H25NO4Rh2 — CID 59733593
2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]benzo[de]isoquinoline-1,3-dione;bis(rhodium) (PubChem CID 59733593) has the molecular formula C24H25NO4Rh2 and a molecular weight of 597.28 g/mol. Its IUPAC name is 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]benzo[de]isoquinoline-1,3-dione;bis(rhodium).
| Compound Name | 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]benzo[de]isoquinoline-1,3-dione;bis(rhodium) |
|---|---|
| PubChem CID | 59733593 |
| Molecular Formula | C24H25NO4Rh2 |
| Molecular Weight | 597.28 g/mol |
| Exact Mass | 596.99 |
| IUPAC Name | 2-[(1S)-1-(1-adamantyl)-2,2-dihydroxyethyl]benzo[de]isoquinoline-1,3-dione;bis(rhodium) |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1[C@H](C(O)O)C12CC3CC(CC(C3)C1)C2.[Rh].[Rh] |
| InChI | InChI=1S/C24H25NO4.2Rh/c26-21-17-5-1-3-16-4-2-6-18(19(16)17)22(27)25(21)20(23(28)29)24-10-13-7-14(11-24)9-15(8-13)12-24;;/h1-6,13-15,20,23,28-29H,7-12H2;;/t13?,14?,15?,20-,24?;;/m1../s1 |
| InChIKey | ISRCXBJJBUSHST-DPPGNFLYSA-N |
| XLogP | 3.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|