C23H28O3 — CID 59733703
(E)-1-(4-hexoxyphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 59733703) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (E)-1-(4-hexoxyphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-hexoxyphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59733703 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (E)-1-(4-hexoxyphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(C(=O)/C=C/c2cc(C)c(O)c(C)c2)cc1 |
| InChI | InChI=1S/C23H28O3/c1-4-5-6-7-14-26-21-11-9-20(10-12-21)22(24)13-8-19-15-17(2)23(25)18(3)16-19/h8-13,15-16,25H,4-7,14H2,1-3H3/b13-8+ |
| InChIKey | HYOULSUKZMZLCA-MDWZMJQESA-N |
| XLogP | 5.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|