About [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium
[(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium (PubChem CID 59733888) has the molecular formula C6H10N+
and a molecular weight of 96.15 g/mol. Its IUPAC name is [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium.
Molecular Properties
| Compound Name | [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium |
| PubChem CID | 59733888 |
| Molecular Formula | C6H10N+ |
| Molecular Weight | 96.15 g/mol |
| Exact Mass | 96.08 |
| IUPAC Name | [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium |
| SMILES | C=C/C=C\[N+](=C)C |
| InChI | InChI=1S/C6H10N/c1-4-5-6-7(2)3/h4-6H,1-2H2,3H3/q+1/b6-5- |
| InChIKey | DVUBTOINUULEQK-WAYWQWQTSA-N |
| XLogP | 1.03 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium?
The IUPAC name of [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium (CID 59733888) is [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium.
What is the SMILES notation for [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium?
The canonical SMILES for [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium is C=C/C=C\[N+](=C)C.
What is the InChIKey of [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium?
The InChIKey is DVUBTOINUULEQK-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H10N/c1-4-5-6-7(2)3/h4-6H,1-2H2,3H3/q+1/b6-5-.
What are the key properties of [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium?
[(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium has a molecular weight of 96.15 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-buta-1,3-dienyl]-methyl-methylideneazanium is sourced from PubChem (CID 59733888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).