About (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one
(3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one (PubChem CID 59733906) has the molecular formula C24H23NO2
and a molecular weight of 357.45 g/mol. Its IUPAC name is (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one |
| PubChem CID | 59733906 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccccc2)C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C24H23NO2/c26-22(18-10-4-1-5-11-18)17-16-21-23(19-12-6-2-7-13-19)25(24(21)27)20-14-8-3-9-15-20/h1-15,21-23,26H,16-17H2/t21-,22+,23?/m1/s1 |
| InChIKey | PRHFAHPUPSOPID-AXWGZAFASA-N |
| XLogP | 4.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one?
The IUPAC name of (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one (CID 59733906) is (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one.
What is the SMILES notation for (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one?
The canonical SMILES for (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one is O=C1[C@H](CC[C@H](O)c2ccccc2)C(c2ccccc2)N1c1ccccc1.
What is the InChIKey of (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one?
The InChIKey is PRHFAHPUPSOPID-AXWGZAFASA-N. The full InChI is InChI=1S/C24H23NO2/c26-22(18-10-4-1-5-11-18)17-16-21-23(19-12-6-2-7-13-19)25(24(21)27)20-14-8-3-9-15-20/h1-15,21-23,26H,16-17H2/t21-,22+,23?/m1/s1.
What are the key properties of (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one?
(3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one has a molecular weight of 357.45 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1,4-diphenylazetidin-2-one is sourced from PubChem (CID 59733906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).