prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate

C10H17NO4 — CID 59734228

IUPACprop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate
SMILESC=CCOC(=O)N1C(CO)CCC1CO
InChIInChI=1S/C10H17NO4/c1-2-5-15-10(14)11-8(6-12)3-4-9(11)7-13/h2,8-9,12-13H,1,3-7H2
InChIKeyCUCVRPNOKXNSEP-UHFFFAOYSA-N
MW215.25 g/mol
LogP0.13
Rot. Bonds4

About prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate

prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 59734228) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate.

Molecular Properties

Compound Nameprop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate
PubChem CID59734228
Molecular FormulaC10H17NO4
Molecular Weight215.25 g/mol
Exact Mass215.12
IUPAC Nameprop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate
SMILESC=CCOC(=O)N1C(CO)CCC1CO
InChIInChI=1S/C10H17NO4/c1-2-5-15-10(14)11-8(6-12)3-4-9(11)7-13/h2,8-9,12-13H,1,3-7H2
InChIKeyCUCVRPNOKXNSEP-UHFFFAOYSA-N
XLogP0.13
TPSA70.00 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 50.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate (CID 59734228) is prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C(CO)CCC1CO.
What is the InChIKey of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is CUCVRPNOKXNSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-2-5-15-10(14)11-8(6-12)3-4-9(11)7-13/h2,8-9,12-13H,1,3-7H2.
What are the key properties of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 215.25 g/mol, XLogP of 0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 59734228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).