About prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate
prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 59734228) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 59734228 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C(CO)CCC1CO |
| InChI | InChI=1S/C10H17NO4/c1-2-5-15-10(14)11-8(6-12)3-4-9(11)7-13/h2,8-9,12-13H,1,3-7H2 |
| InChIKey | CUCVRPNOKXNSEP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate (CID 59734228) is prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C(CO)CCC1CO.
What is the InChIKey of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is CUCVRPNOKXNSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-2-5-15-10(14)11-8(6-12)3-4-9(11)7-13/h2,8-9,12-13H,1,3-7H2.
What are the key properties of prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate?
prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 215.25 g/mol, XLogP of 0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2,5-bis(hydroxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 59734228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).