About N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine
N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine (PubChem CID 59734363) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine |
| PubChem CID | 59734363 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C=C\N=C\C(C)(C)C |
| InChI | InChI=1S/C11H21N/c1-10(2,3)7-8-12-9-11(4,5)6/h7-9H,1-6H3/b8-7-,12-9+ |
| InChIKey | XFUPZLAWIFFVCN-HVTAIUIQSA-N |
| XLogP | 3.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine?
The IUPAC name of N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine (CID 59734363) is N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine.
What is the SMILES notation for N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine?
The canonical SMILES for N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine is CC(C)(C)/C=C\N=C\C(C)(C)C.
What is the InChIKey of N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine?
The InChIKey is XFUPZLAWIFFVCN-HVTAIUIQSA-N. The full InChI is InChI=1S/C11H21N/c1-10(2,3)7-8-12-9-11(4,5)6/h7-9H,1-6H3/b8-7-,12-9+.
What are the key properties of N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine?
N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine has a molecular weight of 167.30 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-3,3-dimethylbut-1-enyl]-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 59734363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).