C30H60O5Si2Y-2 — CID 59734609
carbanide;methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-oxobutyl)cyclopentyl]heptanoate;yttrium (PubChem CID 59734609) has the molecular formula C30H60O5Si2Y-2 and a molecular weight of 645.88 g/mol. Its IUPAC name is carbanide;methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-oxobutyl)cyclopentyl]heptanoate;yttrium.
| Compound Name | carbanide;methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-oxobutyl)cyclopentyl]heptanoate;yttrium |
|---|---|
| PubChem CID | 59734609 |
| Molecular Formula | C30H60O5Si2Y-2 |
| Molecular Weight | 645.88 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | carbanide;methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-oxobutyl)cyclopentyl]heptanoate;yttrium |
| SMILES | COC(=O)CCCCCC[C@H]1C(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCC[C-]=O.[CH3-].[Y] |
| InChI | InChI=1S/C29H57O5Si2.CH3.Y/c1-28(2,3)35(8,9)33-25-22-26(34-36(10,11)29(4,5)6)24(19-16-17-21-30)23(25)18-14-12-13-15-20-27(31)32-7;;/h23-26H,12-20,22H2,1-11H3;1H3;/q2*-1;/t23-,24-,25?,26?;;/m1../s1 |
| InChIKey | JROAWYJSSPUSFG-UPFRFBKKSA-N |
| XLogP | 8.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.88 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|