About CID 59734777
CID 59734777 (PubChem CID 59734777) has the molecular formula C14H16BF2NO3
and a molecular weight of 295.09 g/mol.
Molecular Properties
| Compound Name | CID 59734777 |
| PubChem CID | 59734777 |
| Molecular Formula | C14H16BF2NO3 |
| Molecular Weight | 295.09 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H](CC1=CC(=CC(=C1)F)F)[C@H]2COC(O2)(C)C |
| InChI | InChI=1S/C14H16BF2NO3/c1-14(2)20-7-12(21-14)11(18-13(15)19)5-8-3-9(16)6-10(17)4-8/h3-4,6,11-12H,5,7H2,1-2H3,(H,18,19)/t11-,12+/m0/s1 |
| InChIKey | LFISJMVHBGQLJK-NWDGAFQWSA-N |
| XLogP | — |
| TPSA | 47.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 373 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59734777 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59734777?
The IUPAC name of CID 59734777 (CID 59734777) is not available.
What is the SMILES notation for CID 59734777?
The canonical SMILES for CID 59734777 is [B]C(=O)N[C@@H](CC1=CC(=CC(=C1)F)F)[C@H]2COC(O2)(C)C.
What is the InChIKey of CID 59734777?
The InChIKey is LFISJMVHBGQLJK-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H16BF2NO3/c1-14(2)20-7-12(21-14)11(18-13(15)19)5-8-3-9(16)6-10(17)4-8/h3-4,6,11-12H,5,7H2,1-2H3,(H,18,19)/t11-,12+/m0/s1.
What are the key properties of CID 59734777?
CID 59734777 has a molecular weight of 295.09 g/mol, XLogP of not available, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59734777 is sourced from PubChem (CID 59734777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).