C29H40F2N2O6 — CID 59734782
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(2-methoxyethoxy)pentan-2-yl]-2-methyl-4-N,4-N-dipropylbenzene-1,4-dicarboxamide (PubChem CID 59734782) has the molecular formula C29H40F2N2O6 and a molecular weight of 550.64 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(2-methoxyethoxy)pentan-2-yl]-2-methyl-4-N,4-N-dipropylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(2-methoxyethoxy)pentan-2-yl]-2-methyl-4-N,4-N-dipropylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 59734782 |
| Molecular Formula | C29H40F2N2O6 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-(2-methoxyethoxy)pentan-2-yl]-2-methyl-4-N,4-N-dipropylbenzene-1,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)C(O)COCCOC)c(C)c1 |
| InChI | InChI=1S/C29H40F2N2O6/c1-5-9-33(10-6-2)29(37)21-7-8-24(19(3)13-21)28(36)32-25(16-20-14-22(30)17-23(31)15-20)27(35)26(34)18-39-12-11-38-4/h7-8,13-15,17,25-27,34-35H,5-6,9-12,16,18H2,1-4H3,(H,32,36)/t25-,26?,27+/m0/s1 |
| InChIKey | SPYSVDTWMBHSDB-DRXLFZDCSA-N |
| XLogP | 3.26 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|