C16H29N4O2+ — CID 59734913
4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)acetyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 59734913) has the molecular formula C16H29N4O2+ and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)acetyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)acetyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59734913 |
| Molecular Formula | C16H29N4O2+ |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)acetyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C(=O)C[N+]23CCC(CC2)CC3)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-2-17-16(22)19-8-6-18(7-9-19)15(21)13-20-10-3-14(4-11-20)5-12-20/h14H,2-13H2,1H3/p+1 |
| InChIKey | YOZZMVMYCNASOG-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|