C11H21F3O4Si — CID 59735078
[4,4-dimethoxy-3-(trifluoromethyl)oxan-3-yl]oxy-trimethylsilane (PubChem CID 59735078) has the molecular formula C11H21F3O4Si and a molecular weight of 302.37 g/mol. Its IUPAC name is [4,4-dimethoxy-3-(trifluoromethyl)oxan-3-yl]oxy-trimethylsilane.
| Compound Name | [4,4-dimethoxy-3-(trifluoromethyl)oxan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 59735078 |
| Molecular Formula | C11H21F3O4Si |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [4,4-dimethoxy-3-(trifluoromethyl)oxan-3-yl]oxy-trimethylsilane |
| SMILES | COC1(OC)CCOCC1(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O4Si/c1-15-10(16-2)6-7-17-8-9(10,11(12,13)14)18-19(3,4)5/h6-8H2,1-5H3 |
| InChIKey | NKMWVFSQSXBCPY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|