C23H24ClF2N3O4S — CID 59735193
6-[(4-chlorophenyl)methyl]-1-(2,4-difluorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 59735193) has the molecular formula C23H24ClF2N3O4S and a molecular weight of 511.98 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-1-(2,4-difluorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-[(4-chlorophenyl)methyl]-1-(2,4-difluorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59735193 |
| Molecular Formula | C23H24ClF2N3O4S |
| Molecular Weight | 511.98 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-1-(2,4-difluorophenyl)sulfonyl-8-propan-2-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)CCN2S(=O)(=O)c2ccc(F)cc2F)C(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C23H24ClF2N3O4S/c1-14(2)27-13-21-28(34(32,33)20-8-7-17(25)12-18(20)26)10-9-22(30)29(21)19(23(27)31)11-15-3-5-16(24)6-4-15/h3-8,12,14,19,21H,9-11,13H2,1-2H3 |
| InChIKey | RJHNMWYPQZVJCS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |