C25H22F3NO3 — CID 59735315
(5S)-3-(2,2,2-trifluoroethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 59735315) has the molecular formula C25H22F3NO3 and a molecular weight of 441.45 g/mol. Its IUPAC name is (5S)-3-(2,2,2-trifluoroethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-(2,2,2-trifluoroethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59735315 |
| Molecular Formula | C25H22F3NO3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (5S)-3-(2,2,2-trifluoroethyl)-5-(trityloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1CC(F)(F)F |
| InChI | InChI=1S/C25H22F3NO3/c26-24(27,28)18-29-16-22(32-23(29)30)17-31-25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22H,16-18H2/t22-/m0/s1 |
| InChIKey | YFIFQVOKDGACQT-QFIPXVFZSA-N |
| XLogP | 5.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|