About 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate
3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 59735639) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| PubChem CID | 59735639 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | COC(C)CCOC(=O)C1CCC2(C)OC2C1 |
| InChI | InChI=1S/C13H22O4/c1-9(15-3)5-7-16-12(14)10-4-6-13(2)11(8-10)17-13/h9-11H,4-8H2,1-3H3 |
| InChIKey | FYIJZEYOXBTRNJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The IUPAC name of 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (CID 59735639) is 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
What is the SMILES notation for 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The canonical SMILES for 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate is COC(C)CCOC(=O)C1CCC2(C)OC2C1.
What is the InChIKey of 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
The InChIKey is FYIJZEYOXBTRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-9(15-3)5-7-16-12(14)10-4-6-13(2)11(8-10)17-13/h9-11H,4-8H2,1-3H3.
What are the key properties of 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate?
3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate has a molecular weight of 242.31 g/mol, XLogP of 1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutyl 6-methyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate is sourced from PubChem (CID 59735639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).