About CID 59735666
CID 59735666 (PubChem CID 59735666) has the molecular formula C26H48NO5S
and a molecular weight of 486.74 g/mol.
Molecular Properties
| Compound Name | CID 59735666 |
| PubChem CID | 59735666 |
| Molecular Formula | C26H48NO5S |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)SC[CH]C(=O)N(C)C |
| InChI | InChI=1S/C26H48NO5S/c1-7-11-13-21(9-3)19-31-25(29)17-23(33-16-15-24(28)27(5)6)18-26(30)32-20-22(10-4)14-12-8-2/h15,21-23H,7-14,16-20H2,1-6H3 |
| InChIKey | HHMMWUYEMPGZQR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 59735666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59735666?
The IUPAC name of CID 59735666 (CID 59735666) is not available.
What is the SMILES notation for CID 59735666?
The canonical SMILES for CID 59735666 is CCCCC(CC)COC(=O)CC(CC(=O)OCC(CC)CCCC)SC[CH]C(=O)N(C)C.
What is the InChIKey of CID 59735666?
The InChIKey is HHMMWUYEMPGZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H48NO5S/c1-7-11-13-21(9-3)19-31-25(29)17-23(33-16-15-24(28)27(5)6)18-26(30)32-20-22(10-4)14-12-8-2/h15,21-23H,7-14,16-20H2,1-6H3.
What are the key properties of CID 59735666?
CID 59735666 has a molecular weight of 486.74 g/mol, XLogP of 5.68, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59735666 is sourced from PubChem (CID 59735666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).