C25H28S2Si — CID 59735671
(4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)-dimethyl-(2,4,6-trimethyl-1H-inden-1-yl)silane (PubChem CID 59735671) has the molecular formula C25H28S2Si and a molecular weight of 420.72 g/mol. Its IUPAC name is (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)-dimethyl-(2,4,6-trimethyl-1H-inden-1-yl)silane.
| Compound Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)-dimethyl-(2,4,6-trimethyl-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 59735671 |
| Molecular Formula | C25H28S2Si |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (4,10-dimethyl-5,9-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraen-7-yl)-dimethyl-(2,4,6-trimethyl-1H-inden-1-yl)silane |
| SMILES | CC1=Cc2c(C)cc(C)cc2C1[Si](C)(C)C1c2sc(C)cc2-c2cc(C)sc21 |
| InChI | InChI=1S/C25H28S2Si/c1-13-8-14(2)18-10-15(3)24(21(18)9-13)28(6,7)25-22-19(11-16(4)26-22)20-12-17(5)27-23(20)25/h8-12,24-25H,1-7H3 |
| InChIKey | LQNOKZGVUPKJDP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|