C25H20F2N2O3S — CID 59735905
3,5-bis[(2-fluorophenyl)methoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 59735905) has the molecular formula C25H20F2N2O3S and a molecular weight of 466.51 g/mol. Its IUPAC name is 3,5-bis[(2-fluorophenyl)methoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3,5-bis[(2-fluorophenyl)methoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 59735905 |
| Molecular Formula | C25H20F2N2O3S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 3,5-bis[(2-fluorophenyl)methoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(OCc3ccccc3F)cc(OCc3ccccc3F)c2)n1 |
| InChI | InChI=1S/C25H20F2N2O3S/c1-16-15-33-25(28-16)29-24(30)19-10-20(31-13-17-6-2-4-8-22(17)26)12-21(11-19)32-14-18-7-3-5-9-23(18)27/h2-12,15H,13-14H2,1H3,(H,28,29,30) |
| InChIKey | VIRNDXZDXKNQTC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |