About CID 59736103
CID 59736103 (PubChem CID 59736103) has the molecular formula C7H12BNO3
and a molecular weight of 168.99 g/mol.
Molecular Properties
| Compound Name | CID 59736103 |
| PubChem CID | 59736103 |
| Molecular Formula | C7H12BNO3 |
| Molecular Weight | 168.99 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | — |
| SMILES | [B]O/N=C(\C)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C7H12BNO3/c1-4(2)6(7(10)11)5(3)9-12-8/h4,6H,1-3H3,(H,10,11)/b9-5+/t6-/m1/s1 |
| InChIKey | GOAAZNASTMBGFC-KCXGFMAWSA-N |
| XLogP | 0.82 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.99 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59736103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59736103?
The IUPAC name of CID 59736103 (CID 59736103) is not available.
What is the SMILES notation for CID 59736103?
The canonical SMILES for CID 59736103 is [B]O/N=C(\C)[C@H](C(=O)O)C(C)C.
What is the InChIKey of CID 59736103?
The InChIKey is GOAAZNASTMBGFC-KCXGFMAWSA-N. The full InChI is InChI=1S/C7H12BNO3/c1-4(2)6(7(10)11)5(3)9-12-8/h4,6H,1-3H3,(H,10,11)/b9-5+/t6-/m1/s1.
What are the key properties of CID 59736103?
CID 59736103 has a molecular weight of 168.99 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59736103 is sourced from PubChem (CID 59736103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).