C16H26N4O — CID 59736207
2,4-ditert-butyl-6-phenyl-1,2,4,5-tetrazinan-3-one (PubChem CID 59736207) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-phenyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 2,4-ditert-butyl-6-phenyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 59736207 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2,4-ditert-butyl-6-phenyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CC(C)(C)N1NC(c2ccccc2)NN(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H26N4O/c1-15(2,3)19-14(21)20(16(4,5)6)18-13(17-19)12-10-8-7-9-11-12/h7-11,13,17-18H,1-6H3 |
| InChIKey | MYHFLBQGJNPCKO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |