C36H66N12O3 — CID 59736238
6-[3,5-bis(1,5-ditert-butyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-ditert-butyl-1,2,4,5-tetrazinan-3-one (PubChem CID 59736238) has the molecular formula C36H66N12O3 and a molecular weight of 715.01 g/mol. Its IUPAC name is 6-[3,5-bis(1,5-ditert-butyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-ditert-butyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-[3,5-bis(1,5-ditert-butyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-ditert-butyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 59736238 |
| Molecular Formula | C36H66N12O3 |
| Molecular Weight | 715.01 g/mol |
| Exact Mass | 714.54 |
| IUPAC Name | 6-[3,5-bis(1,5-ditert-butyl-6-oxo-1,2,4,5-tetrazinan-3-yl)phenyl]-2,4-ditert-butyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CC(C)(C)N1NC(c2cc(C3NN(C(C)(C)C)C(=O)N(C(C)(C)C)N3)cc(C3NN(C(C)(C)C)C(=O)N(C(C)(C)C)N3)c2)NN(C(C)(C)C)C1=O |
| InChI | InChI=1S/C36H66N12O3/c1-31(2,3)43-28(49)44(32(4,5)6)38-25(37-43)22-19-23(26-39-45(33(7,8)9)29(50)46(40-26)34(10,11)12)21-24(20-22)27-41-47(35(13,14)15)30(51)48(42-27)36(16,17)18/h19-21,25-27,37-42H,1-18H3 |
| InChIKey | ZSLLSIIKRJJKFE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.01 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |