C18H10Cl6N4O2 — CID 59736299
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(4-hydroxyphenyl)benzamide (PubChem CID 59736299) has the molecular formula C18H10Cl6N4O2 and a molecular weight of 527.02 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(4-hydroxyphenyl)benzamide.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 59736299 |
| Molecular Formula | C18H10Cl6N4O2 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 523.89 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(4-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C18H10Cl6N4O2/c19-17(20,21)15-26-13(27-16(28-15)18(22,23)24)9-1-3-10(4-2-9)14(30)25-11-5-7-12(29)8-6-11/h1-8,29H,(H,25,30) |
| InChIKey | ZRSOADMERGYWKP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|