C9H8F12O3 — CID 59736318
1,1,2,2,3,4,4,5,5-nonafluoro-1,5-dimethoxy-3-(2,2,2-trifluoroethoxy)pentane (PubChem CID 59736318) has the molecular formula C9H8F12O3 and a molecular weight of 392.14 g/mol. Its IUPAC name is 1,1,2,2,3,4,4,5,5-nonafluoro-1,5-dimethoxy-3-(2,2,2-trifluoroethoxy)pentane.
| Compound Name | 1,1,2,2,3,4,4,5,5-nonafluoro-1,5-dimethoxy-3-(2,2,2-trifluoroethoxy)pentane |
|---|---|
| PubChem CID | 59736318 |
| Molecular Formula | C9H8F12O3 |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 1,1,2,2,3,4,4,5,5-nonafluoro-1,5-dimethoxy-3-(2,2,2-trifluoroethoxy)pentane |
| SMILES | COC(F)(F)C(F)(F)C(F)(OCC(F)(F)F)C(F)(F)C(F)(F)OC |
| InChI | InChI=1S/C9H8F12O3/c1-22-8(18,19)5(13,14)7(17,24-3-4(10,11)12)6(15,16)9(20,21)23-2/h3H2,1-2H3 |
| InChIKey | NRKRTPGZBKIYQV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|