C66H61N — CID 59736370
2,7-bis(2,7-ditert-butylpyren-4-yl)-9-phenylcarbazole (PubChem CID 59736370) has the molecular formula C66H61N and a molecular weight of 868.22 g/mol. Its IUPAC name is 2,7-bis(2,7-ditert-butylpyren-4-yl)-9-phenylcarbazole.
| Compound Name | 2,7-bis(2,7-ditert-butylpyren-4-yl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 59736370 |
| Molecular Formula | C66H61N |
| Molecular Weight | 868.22 g/mol |
| Exact Mass | 867.48 |
| IUPAC Name | 2,7-bis(2,7-ditert-butylpyren-4-yl)-9-phenylcarbazole |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c(-c5ccc6c7ccc(-c8cc9cc(C(C)(C)C)cc%10ccc%11cc(C(C)(C)C)cc8c%11c%109)cc7n(-c7ccccc7)c6c5)cc(c1)c2c34 |
| InChI | InChI=1S/C66H61N/c1-63(2,3)46-26-40-18-20-42-28-48(65(7,8)9)36-55-53(32-44(30-46)59(40)61(42)55)38-22-24-51-52-25-23-39(35-58(52)67(57(51)34-38)50-16-14-13-15-17-50)54-33-45-31-47(64(4,5)6)27-41-19-21-43-29-49(66(10,11)12)37-56(54)62(43)60(41)45/h13-37H,1-12H3 |
| InChIKey | FAQHBXVNXVEZFE-UHFFFAOYSA-N |
| XLogP | 19.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.22 |
| LogP ≤ 5 | 19.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|