About 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid
3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 59736396) has the molecular formula C16H24O7
and a molecular weight of 328.36 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| PubChem CID | 59736396 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCOCOC1C2C=CC(O2)C1C(=O)O |
| InChI | InChI=1S/C16H24O7/c1-4-16(2,3)15(19)21-8-7-20-9-22-13-11-6-5-10(23-11)12(13)14(17)18/h5-6,10-13H,4,7-9H2,1-3H3,(H,17,18) |
| InChIKey | BQHCKGVBIMPMAO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The IUPAC name of 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CID 59736396) is 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
What is the SMILES notation for 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The canonical SMILES for 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid is CCC(C)(C)C(=O)OCCOCOC1C2C=CC(O2)C1C(=O)O.
What is the InChIKey of 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The InChIKey is BQHCKGVBIMPMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O7/c1-4-16(2,3)15(19)21-8-7-20-9-22-13-11-6-5-10(23-11)12(13)14(17)18/h5-6,10-13H,4,7-9H2,1-3H3,(H,17,18).
What are the key properties of 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid has a molecular weight of 328.36 g/mol, XLogP of 1.36, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-dimethylbutanoyloxy)ethoxymethoxy]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid is sourced from PubChem (CID 59736396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).