C57H40N4O2 — CID 59736459
2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2-methylphenyl]-4,7-diphenyl-1,10-phenanthroline (PubChem CID 59736459) has the molecular formula C57H40N4O2 and a molecular weight of 812.97 g/mol. Its IUPAC name is 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2-methylphenyl]-4,7-diphenyl-1,10-phenanthroline.
| Compound Name | 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2-methylphenyl]-4,7-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 59736459 |
| Molecular Formula | C57H40N4O2 |
| Molecular Weight | 812.97 g/mol |
| Exact Mass | 812.32 |
| IUPAC Name | 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2-methylphenyl]-4,7-diphenyl-1,10-phenanthroline |
| SMILES | COc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(-c4ccc(-c5cc(-c6ccccc6)c6ccc7c(-c8ccccc8)cc(OC)nc7c6n5)c(C)c4)nc3c2n1 |
| InChI | InChI=1S/C57H40N4O2/c1-35-30-40(50-31-46(36-16-8-4-9-17-36)42-26-28-44-48(38-20-12-6-13-21-38)33-52(62-2)60-56(44)54(42)58-50)24-25-41(35)51-32-47(37-18-10-5-11-19-37)43-27-29-45-49(39-22-14-7-15-23-39)34-53(63-3)61-57(45)55(43)59-51/h4-34H,1-3H3 |
| InChIKey | WXIVJALQLDLNGU-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.97 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|