C34H24F2N4 — CID 59736516
2-fluoro-9-[4-(9-fluoro-4,7-dimethyl-1,10-phenanthrolin-2-yl)phenyl]-4,7-dimethyl-1,10-phenanthroline (PubChem CID 59736516) has the molecular formula C34H24F2N4 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-fluoro-9-[4-(9-fluoro-4,7-dimethyl-1,10-phenanthrolin-2-yl)phenyl]-4,7-dimethyl-1,10-phenanthroline.
| Compound Name | 2-fluoro-9-[4-(9-fluoro-4,7-dimethyl-1,10-phenanthrolin-2-yl)phenyl]-4,7-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 59736516 |
| Molecular Formula | C34H24F2N4 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-fluoro-9-[4-(9-fluoro-4,7-dimethyl-1,10-phenanthrolin-2-yl)phenyl]-4,7-dimethyl-1,10-phenanthroline |
| SMILES | Cc1cc(F)nc2c1ccc1c(C)cc(-c3ccc(-c4cc(C)c5ccc6c(C)cc(F)nc6c5n4)cc3)nc12 |
| InChI | InChI=1S/C34H24F2N4/c1-17-13-27(37-31-23(17)9-11-25-19(3)15-29(35)39-33(25)31)21-5-7-22(8-6-21)28-14-18(2)24-10-12-26-20(4)16-30(36)40-34(26)32(24)38-28/h5-16H,1-4H3 |
| InChIKey | HRBDXSSNAZQVAQ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|