C36H32N6 — CID 59736535
9-[4-[9-(dimethylamino)-1,10-phenanthrolin-2-yl]-2,5-dimethylphenyl]-N,N-dimethyl-1,10-phenanthrolin-2-amine (PubChem CID 59736535) has the molecular formula C36H32N6 and a molecular weight of 548.69 g/mol. Its IUPAC name is 9-[4-[9-(dimethylamino)-1,10-phenanthrolin-2-yl]-2,5-dimethylphenyl]-N,N-dimethyl-1,10-phenanthrolin-2-amine.
| Compound Name | 9-[4-[9-(dimethylamino)-1,10-phenanthrolin-2-yl]-2,5-dimethylphenyl]-N,N-dimethyl-1,10-phenanthrolin-2-amine |
|---|---|
| PubChem CID | 59736535 |
| Molecular Formula | C36H32N6 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 9-[4-[9-(dimethylamino)-1,10-phenanthrolin-2-yl]-2,5-dimethylphenyl]-N,N-dimethyl-1,10-phenanthrolin-2-amine |
| SMILES | Cc1cc(-c2ccc3ccc4ccc(N(C)C)nc4c3n2)c(C)cc1-c1ccc2ccc3ccc(N(C)C)nc3c2n1 |
| InChI | InChI=1S/C36H32N6/c1-21-19-28(30-16-12-24-8-10-26-14-18-32(42(5)6)40-36(26)34(24)38-30)22(2)20-27(21)29-15-11-23-7-9-25-13-17-31(41(3)4)39-35(25)33(23)37-29/h7-20H,1-6H3 |
| InChIKey | MINYJAGQUPSJOG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|