C58H42N4O2 — CID 59736546
2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2,5-dimethylphenyl]-4,7-diphenyl-1,10-phenanthroline (PubChem CID 59736546) has the molecular formula C58H42N4O2 and a molecular weight of 827.00 g/mol. Its IUPAC name is 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2,5-dimethylphenyl]-4,7-diphenyl-1,10-phenanthroline.
| Compound Name | 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2,5-dimethylphenyl]-4,7-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 59736546 |
| Molecular Formula | C58H42N4O2 |
| Molecular Weight | 827.00 g/mol |
| Exact Mass | 826.33 |
| IUPAC Name | 2-methoxy-9-[4-(9-methoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl)-2,5-dimethylphenyl]-4,7-diphenyl-1,10-phenanthroline |
| SMILES | COc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(-c4cc(C)c(-c5cc(-c6ccccc6)c6ccc7c(-c8ccccc8)cc(OC)nc7c6n5)cc4C)nc3c2n1 |
| InChI | InChI=1S/C58H42N4O2/c1-35-29-46(52-32-48(38-19-11-6-12-20-38)42-26-28-44-50(40-23-15-8-16-24-40)34-54(64-4)62-58(44)56(42)60-52)36(2)30-45(35)51-31-47(37-17-9-5-10-18-37)41-25-27-43-49(39-21-13-7-14-22-39)33-53(63-3)61-57(43)55(41)59-51/h5-34H,1-4H3 |
| InChIKey | UETZZSUAJKJUIS-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.00 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|