C10H19NO3 — CID 59736604
1,6,8-trimethyl-2,5a,6,8,9,9a-hexahydropyrano[4,3-f][1,3,5]dioxazepine (PubChem CID 59736604) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1,6,8-trimethyl-2,5a,6,8,9,9a-hexahydropyrano[4,3-f][1,3,5]dioxazepine.
| Compound Name | 1,6,8-trimethyl-2,5a,6,8,9,9a-hexahydropyrano[4,3-f][1,3,5]dioxazepine |
|---|---|
| PubChem CID | 59736604 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1,6,8-trimethyl-2,5a,6,8,9,9a-hexahydropyrano[4,3-f][1,3,5]dioxazepine |
| SMILES | CC1CC2C(OCOCN2C)C(C)O1 |
| InChI | InChI=1S/C10H19NO3/c1-7-4-9-10(8(2)14-7)13-6-12-5-11(9)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | DKNIUZYSOUCUDR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |