C10H20N2O4S — CID 59736633
(7S,9S)-3,5,7,9-tetramethyl-4,5a,6,7,9,9a-hexahydropyrano[4,3-f][1,2,3,5]oxathiadiazepine 2,2-dioxide (PubChem CID 59736633) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (7S,9S)-3,5,7,9-tetramethyl-4,5a,6,7,9,9a-hexahydropyrano[4,3-f][1,2,3,5]oxathiadiazepine 2,2-dioxide.
| Compound Name | (7S,9S)-3,5,7,9-tetramethyl-4,5a,6,7,9,9a-hexahydropyrano[4,3-f][1,2,3,5]oxathiadiazepine 2,2-dioxide |
|---|---|
| PubChem CID | 59736633 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (7S,9S)-3,5,7,9-tetramethyl-4,5a,6,7,9,9a-hexahydropyrano[4,3-f][1,2,3,5]oxathiadiazepine 2,2-dioxide |
| SMILES | C[C@@H]1O[C@@H](C)CC2C1OS(=O)(=O)N(C)CN2C |
| InChI | InChI=1S/C10H20N2O4S/c1-7-5-9-10(8(2)15-7)16-17(13,14)12(4)6-11(9)3/h7-10H,5-6H2,1-4H3/t7-,8-,9?,10?/m0/s1 |
| InChIKey | VBBWJSJQTQRVQD-DKEVHCRPSA-N |
| XLogP | 0.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |