C20H13F5N2O4S2 — CID 59737873
[4-[(2,6-difluorophenyl)carbamoyl]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-13-yl] trifluoromethanesulfonate (PubChem CID 59737873) has the molecular formula C20H13F5N2O4S2 and a molecular weight of 504.46 g/mol. Its IUPAC name is [4-[(2,6-difluorophenyl)carbamoyl]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-13-yl] trifluoromethanesulfonate.
| Compound Name | [4-[(2,6-difluorophenyl)carbamoyl]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-13-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59737873 |
| Molecular Formula | C20H13F5N2O4S2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | [4-[(2,6-difluorophenyl)carbamoyl]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-13-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1c(F)cccc1F)c1nc2c(s1)-c1cc(OS(=O)(=O)C(F)(F)F)ccc1CCC2 |
| InChI | InChI=1S/C20H13F5N2O4S2/c21-13-4-2-5-14(22)16(13)27-18(28)19-26-15-6-1-3-10-7-8-11(9-12(10)17(15)32-19)31-33(29,30)20(23,24)25/h2,4-5,7-9H,1,3,6H2,(H,27,28) |
| InChIKey | GWSSLNNFTOFLAW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|