C19H14F3N3O3S — CID 59738056
(4-pyridin-3-yl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl) trifluoromethanesulfonate (PubChem CID 59738056) has the molecular formula C19H14F3N3O3S and a molecular weight of 421.40 g/mol. Its IUPAC name is (4-pyridin-3-yl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl) trifluoromethanesulfonate.
| Compound Name | (4-pyridin-3-yl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59738056 |
| Molecular Formula | C19H14F3N3O3S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (4-pyridin-3-yl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-13-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)CCCc1cnc(-c3cccnc3)nc1-2)C(F)(F)F |
| InChI | InChI=1S/C19H14F3N3O3S/c20-19(21,22)29(26,27)28-15-6-7-16-12(9-15)3-1-4-13-11-24-18(25-17(13)16)14-5-2-8-23-10-14/h2,5-11H,1,3-4H2 |
| InChIKey | VCHKWDDDJBQAPI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|