C25H18F6N2O6 — CID 59739506
4-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-9-methyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 59739506) has the molecular formula C25H18F6N2O6 and a molecular weight of 556.42 g/mol. Its IUPAC name is 4-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-9-methyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 4-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-9-methyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 59739506 |
| Molecular Formula | C25H18F6N2O6 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 4-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-9-methyl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | Cc1cc(C(c2ccc(O)c(N3C(=O)C4C5C(=O)N(C)C(=O)C5C4C3=O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C25H18F6N2O6/c1-9-7-10(3-5-13(9)34)23(24(26,27)28,25(29,30)31)11-4-6-14(35)12(8-11)33-21(38)17-15-16(18(17)22(33)39)20(37)32(2)19(15)36/h3-8,15-18,34-35H,1-2H3 |
| InChIKey | CTRLSUJFEBCLIP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|