C8H10BrNO — CID 59739617
4-(Bromomethyl)-3-cyclopropyl-5-methyl-1,2-oxazole (PubChem CID 59739617) has the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. Its IUPAC name is 4-(bromomethyl)-3-cyclopropyl-5-methyl-1,2-oxazole.
| Compound Name | 4-(Bromomethyl)-3-cyclopropyl-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 59739617 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 4-(bromomethyl)-3-cyclopropyl-5-methyl-1,2-oxazole |
| SMILES | CC1=C(C(=NO1)C2CC2)CBr |
| InChI | InChI=1S/C8H10BrNO/c1-5-7(4-9)8(10-11-5)6-2-3-6/h6H,2-4H2,1H3 |
| InChIKey | WOANQXGRYINFQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 149 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|