C27H21NO8 — CID 59739706
[(2S,3R,4S)-4-benzamido-2-(1-benzoyloxy-2-oxoethyl)-5-oxooxolan-3-yl] benzoate (PubChem CID 59739706) has the molecular formula C27H21NO8 and a molecular weight of 487.46 g/mol. Its IUPAC name is [(2S,3R,4S)-4-benzamido-2-(1-benzoyloxy-2-oxoethyl)-5-oxooxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S)-4-benzamido-2-(1-benzoyloxy-2-oxoethyl)-5-oxooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59739706 |
| Molecular Formula | C27H21NO8 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [(2S,3R,4S)-4-benzamido-2-(1-benzoyloxy-2-oxoethyl)-5-oxooxolan-3-yl] benzoate |
| SMILES | O=CC(OC(=O)c1ccccc1)[C@H]1OC(=O)[C@@H](NC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21NO8/c29-16-20(34-25(31)18-12-6-2-7-13-18)22-23(36-26(32)19-14-8-3-9-15-19)21(27(33)35-22)28-24(30)17-10-4-1-5-11-17/h1-16,20-23H,(H,28,30)/t20?,21-,22+,23+/m0/s1 |
| InChIKey | JORRWKITFUXVTF-CMDJAWNXSA-N |
| XLogP | 2.36 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|