C24H28FNO5 — CID 59739816
(2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739816) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739816 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3cc(C)cc(F)c23)cc1 |
| InChI | InChI=1S/C24H28FNO5/c1-3-14-4-6-15(7-5-14)10-16-11-26(18-9-13(2)8-17(25)20(16)18)24-23(30)22(29)21(28)19(12-27)31-24/h4-9,11,19,21-24,27-30H,3,10,12H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | QAMCIOVZLFURMB-PFKOEMKTSA-N |
| XLogP | 2.21 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |