C27H27NO7 — CID 59739887
[6-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]naphthalen-2-yl] acetate (PubChem CID 59739887) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is [6-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]naphthalen-2-yl] acetate.
| Compound Name | [6-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 59739887 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [6-[[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2cc(Cc3cn([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c4ccccc34)ccc2c1 |
| InChI | InChI=1S/C27H27NO7/c1-15(30)34-20-9-8-17-10-16(6-7-18(17)12-20)11-19-13-28(22-5-3-2-4-21(19)22)27-26(33)25(32)24(31)23(14-29)35-27/h2-10,12-13,23-27,29,31-33H,11,14H2,1H3/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | QKSWGKJHCFRDBN-IURCNINISA-N |
| XLogP | 2.28 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|