C23H26FNO5 — CID 59739951
(2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-5-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739951) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-5-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-5-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739951 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-5-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C23H26FNO5/c1-2-13-3-5-14(6-4-13)9-15-11-25(18-8-7-16(24)10-17(15)18)23-22(29)21(28)20(27)19(12-26)30-23/h3-8,10-11,19-23,26-29H,2,9,12H2,1H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | UGXJSBUSWYZWCW-XNBWIAOKSA-N |
| XLogP | 1.91 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |