C24H28FNO6 — CID 59740045
(2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxypropyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740045) has the molecular formula C24H28FNO6 and a molecular weight of 445.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxypropyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxypropyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740045 |
| Molecular Formula | C24H28FNO6 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxypropyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCCCc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3cccc(F)c23)cc1 |
| InChI | InChI=1S/C24H28FNO6/c25-17-4-1-5-18-20(17)16(11-15-8-6-14(7-9-15)3-2-10-27)12-26(18)24-23(31)22(30)21(29)19(13-28)32-24/h1,4-9,12,19,21-24,27-31H,2-3,10-11,13H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | DBGGCUXCVSOTKV-PFKOEMKTSA-N |
| XLogP | 1.27 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |