C26H32N2O6 — CID 59740083
4-[4-[[4-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]phenyl]butanamide (PubChem CID 59740083) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[4-[[4-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]phenyl]butanamide.
| Compound Name | 4-[4-[[4-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 59740083 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-[4-[[4-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methyl]phenyl]butanamide |
| SMILES | Cc1cccc2c1c(Cc1ccc(CCCC(N)=O)cc1)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H32N2O6/c1-15-4-2-6-19-22(15)18(12-17-10-8-16(9-11-17)5-3-7-21(27)30)13-28(19)26-25(33)24(32)23(31)20(14-29)34-26/h2,4,6,8-11,13,20,23-26,29,31-33H,3,5,7,12,14H2,1H3,(H2,27,30)/t20-,23-,24+,25-,26-/m1/s1 |
| InChIKey | LETNVTYWENNWMT-DDLBMNSQSA-N |
| XLogP | 1.32 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |