C26H32FNO6 — CID 59740225
(2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxy-3-methylbutyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740225) has the molecular formula C26H32FNO6 and a molecular weight of 473.54 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxy-3-methylbutyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxy-3-methylbutyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740225 |
| Molecular Formula | C26H32FNO6 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[[4-(3-hydroxy-3-methylbutyl)phenyl]methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(O)CCc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3cccc(F)c23)cc1 |
| InChI | InChI=1S/C26H32FNO6/c1-26(2,33)11-10-15-6-8-16(9-7-15)12-17-13-28(19-5-3-4-18(27)21(17)19)25-24(32)23(31)22(30)20(14-29)34-25/h3-9,13,20,22-25,29-33H,10-12,14H2,1-2H3/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | FLRFPOOLBLYTGJ-PRDVQWLOSA-N |
| XLogP | 2.05 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |