C22H25NO7S — CID 59740293
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[7-methoxy-3-(4-methoxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol (PubChem CID 59740293) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[7-methoxy-3-(4-methoxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[7-methoxy-3-(4-methoxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740293 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[7-methoxy-3-(4-methoxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(OC)cccc23)cc1 |
| InChI | InChI=1S/C22H25NO7S/c1-28-12-6-8-13(9-7-12)31-17-10-23(18-14(17)4-3-5-15(18)29-2)22-21(27)20(26)19(25)16(11-24)30-22/h3-10,16,19-22,24-27H,11H2,1-2H3/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | MCMSWMXRUOCTCF-RECXWPGBSA-N |
| XLogP | 1.78 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |